C19H25NOS — CID 58914188
5-[N-ethyl-4-[(E)-2-thiophen-2-ylethenyl]anilino]pentan-1-ol (PubChem CID 58914188) has the molecular formula C19H25NOS and a molecular weight of 315.48 g/mol. Its IUPAC name is 5-[N-ethyl-4-[(E)-2-thiophen-2-ylethenyl]anilino]pentan-1-ol.
| Compound Name | 5-[N-ethyl-4-[(E)-2-thiophen-2-ylethenyl]anilino]pentan-1-ol |
|---|---|
| PubChem CID | 58914188 |
| Molecular Formula | C19H25NOS |
| Molecular Weight | 315.48 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 5-[N-ethyl-4-[(E)-2-thiophen-2-ylethenyl]anilino]pentan-1-ol |
| SMILES | CCN(CCCCCO)c1ccc(/C=C/c2cccs2)cc1 |
| InChI | InChI=1S/C19H25NOS/c1-2-20(14-4-3-5-15-21)18-11-8-17(9-12-18)10-13-19-7-6-16-22-19/h6-13,16,21H,2-5,14-15H2,1H3/b13-10+ |
| InChIKey | ZGKAZUGARBIVLJ-JLHYYAGUSA-N |
| XLogP | 4.91 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.48 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|