C17H20N2+2 — CID 3991760
4-ethenyl-1-[3-(4-ethenylpyridin-1-ium-1-yl)propyl]pyridin-1-ium (PubChem CID 3991760) has the molecular formula C17H20N2+2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 4-ethenyl-1-[3-(4-ethenylpyridin-1-ium-1-yl)propyl]pyridin-1-ium.
| Compound Name | 4-ethenyl-1-[3-(4-ethenylpyridin-1-ium-1-yl)propyl]pyridin-1-ium |
|---|---|
| PubChem CID | 3991760 |
| Molecular Formula | C17H20N2+2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | 4-ethenyl-1-[3-(4-ethenylpyridin-1-ium-1-yl)propyl]pyridin-1-ium |
| SMILES | C=Cc1cc[n+](CCC[n+]2ccc(C=C)cc2)cc1 |
| InChI | InChI=1S/C17H20N2/c1-3-16-6-12-18(13-7-16)10-5-11-19-14-8-17(4-2)9-15-19/h3-4,6-9,12-15H,1-2,5,10-11H2/q+2 |
| InChIKey | QFLLIJRXFBTPJO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 7.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|