C17H22N2O+2 — CID 171628665
[(2Z,4Z)-3-ethenyl-5-[3-(4-ethenylpyridin-1-ium-1-yl)propoxy]penta-2,4-dienylidene]azanium (PubChem CID 171628665) has the molecular formula C17H22N2O+2 and a molecular weight of 270.38 g/mol. Its IUPAC name is [(2Z,4Z)-3-ethenyl-5-[3-(4-ethenylpyridin-1-ium-1-yl)propoxy]penta-2,4-dienylidene]azanium.
| Compound Name | [(2Z,4Z)-3-ethenyl-5-[3-(4-ethenylpyridin-1-ium-1-yl)propoxy]penta-2,4-dienylidene]azanium |
|---|---|
| PubChem CID | 171628665 |
| Molecular Formula | C17H22N2O+2 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | [(2Z,4Z)-3-ethenyl-5-[3-(4-ethenylpyridin-1-ium-1-yl)propoxy]penta-2,4-dienylidene]azanium |
| SMILES | C=CC(/C=C\OCCC[n+]1ccc(C=C)cc1)=C/C=[NH2+] |
| InChI | InChI=1S/C17H21N2O/c1-3-16(6-10-18)9-15-20-14-5-11-19-12-7-17(4-2)8-13-19/h3-4,6-10,12-13,15,18H,1-2,5,11,14H2/q+1/p+1/b15-9-,16-6-,18-10? |
| InChIKey | NUWLHSRCOSEOEL-XDDQCCDUSA-O |
| XLogP | 1.48 |
| TPSA | 38.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|