C16H18ClN2O2+ — CID 10883544
3-[4-[(E)-(2-chlorophenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propan-1-ol (PubChem CID 10883544) has the molecular formula C16H18ClN2O2+ and a molecular weight of 305.79 g/mol. Its IUPAC name is 3-[4-[(E)-(2-chlorophenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propan-1-ol.
| Compound Name | 3-[4-[(E)-(2-chlorophenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propan-1-ol |
|---|---|
| PubChem CID | 10883544 |
| Molecular Formula | C16H18ClN2O2+ |
| Molecular Weight | 305.79 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-[4-[(E)-(2-chlorophenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propan-1-ol |
| SMILES | OCCC[n+]1ccc(/C=N/OCc2ccccc2Cl)cc1 |
| InChI | InChI=1S/C16H18ClN2O2/c17-16-5-2-1-4-15(16)13-21-18-12-14-6-9-19(10-7-14)8-3-11-20/h1-2,4-7,9-10,12,20H,3,8,11,13H2/q+1/b18-12+ |
| InChIKey | MFWYOVDXXVIENE-LDADJPATSA-N |
| XLogP | 2.56 |
| TPSA | 45.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|