C31H34N4O4+2 — CID 11193273
(E)-N-[(4-methoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(4-methoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine (PubChem CID 11193273) has the molecular formula C31H34N4O4+2 and a molecular weight of 526.64 g/mol. Its IUPAC name is (E)-N-[(4-methoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(4-methoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine.
| Compound Name | (E)-N-[(4-methoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(4-methoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine |
|---|---|
| PubChem CID | 11193273 |
| Molecular Formula | C31H34N4O4+2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.26 |
| IUPAC Name | (E)-N-[(4-methoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(4-methoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine |
| SMILES | COc1ccc(CO/N=C/c2cc[n+](CCC[n+]3ccc(/C=N/OCc4ccc(OC)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C31H34N4O4/c1-36-30-8-4-28(5-9-30)24-38-32-22-26-12-18-34(19-13-26)16-3-17-35-20-14-27(15-21-35)23-33-39-25-29-6-10-31(37-2)11-7-29/h4-15,18-23H,3,16-17,24-25H2,1-2H3/q+2/b32-22+,33-23+ |
| InChIKey | KHSWKWIEGGOOKV-VDTYKYKFSA-N |
| XLogP | 4.47 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|