C33H38N4O6+2 — CID 11445592
(E)-N-[(2,5-dimethoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(2,5-dimethoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine (PubChem CID 11445592) has the molecular formula C33H38N4O6+2 and a molecular weight of 586.69 g/mol. Its IUPAC name is (E)-N-[(2,5-dimethoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(2,5-dimethoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine.
| Compound Name | (E)-N-[(2,5-dimethoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(2,5-dimethoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine |
|---|---|
| PubChem CID | 11445592 |
| Molecular Formula | C33H38N4O6+2 |
| Molecular Weight | 586.69 g/mol |
| Exact Mass | 586.28 |
| IUPAC Name | (E)-N-[(2,5-dimethoxyphenyl)methoxy]-1-[1-[3-[4-[(E)-(2,5-dimethoxyphenyl)methoxyiminomethyl]pyridin-1-ium-1-yl]propyl]pyridin-1-ium-4-yl]methanimine |
| SMILES | COc1ccc(OC)c(CO/N=C/c2cc[n+](CCC[n+]3ccc(/C=N/OCc4cc(OC)ccc4OC)cc3)cc2)c1 |
| InChI | InChI=1S/C33H38N4O6/c1-38-30-6-8-32(40-3)28(20-30)24-42-34-22-26-10-16-36(17-11-26)14-5-15-37-18-12-27(13-19-37)23-35-43-25-29-21-31(39-2)7-9-33(29)41-4/h6-13,16-23H,5,14-15,24-25H2,1-4H3/q+2/b34-22+,35-23+ |
| InChIKey | NBUUEDMBRMLGPG-RSVUCGLWSA-N |
| XLogP | 4.49 |
| TPSA | 87.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|