C14H18F6N2O5S2 — CID 166527307
bis(trifluoromethylsulfonyl)azanide;1-hex-1-en-2-yloxy-4-methylpyridin-1-ium (PubChem CID 166527307) has the molecular formula C14H18F6N2O5S2 and a molecular weight of 472.43 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-hex-1-en-2-yloxy-4-methylpyridin-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-hex-1-en-2-yloxy-4-methylpyridin-1-ium |
|---|---|
| PubChem CID | 166527307 |
| Molecular Formula | C14H18F6N2O5S2 |
| Molecular Weight | 472.43 g/mol |
| Exact Mass | 472.06 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-hex-1-en-2-yloxy-4-methylpyridin-1-ium |
| SMILES | C=C(CCCC)O[n+]1ccc(C)cc1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H18NO.C2F6NO4S2/c1-4-5-6-12(3)14-13-9-7-11(2)8-10-13;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h7-10H,3-6H2,1-2H3;/q+1;-1 |
| InChIKey | AHBXHRQMMRSSFP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 95.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|