C16H32F6NO5PS2 — CID 158418130
bis(trifluoromethylsulfonyl)azanide;tributyl(methoxymethyl)phosphanium (PubChem CID 158418130) has the molecular formula C16H32F6NO5PS2 and a molecular weight of 527.53 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;tributyl(methoxymethyl)phosphanium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;tributyl(methoxymethyl)phosphanium |
|---|---|
| PubChem CID | 158418130 |
| Molecular Formula | C16H32F6NO5PS2 |
| Molecular Weight | 527.53 g/mol |
| Exact Mass | 527.14 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;tributyl(methoxymethyl)phosphanium |
| SMILES | CCCC[P+](CCCC)(CCCC)COC.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H32OP.C2F6NO4S2/c1-5-8-11-16(14-15-4,12-9-6-2)13-10-7-3;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5-14H2,1-4H3;/q+1;-1 |
| InChIKey | HADRRAJYGMXSLK-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 91.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|