C17H28F6N4O4S2 — CID 140870297
bis(trifluoromethylsulfonyl)azanide;1-decyl-4-ethenyl-3-methyltriazol-1-ium (PubChem CID 140870297) has the molecular formula C17H28F6N4O4S2 and a molecular weight of 530.56 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-decyl-4-ethenyl-3-methyltriazol-1-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-decyl-4-ethenyl-3-methyltriazol-1-ium |
|---|---|
| PubChem CID | 140870297 |
| Molecular Formula | C17H28F6N4O4S2 |
| Molecular Weight | 530.56 g/mol |
| Exact Mass | 530.15 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-decyl-4-ethenyl-3-methyltriazol-1-ium |
| SMILES | C=Cc1c[n+](CCCCCCCCCC)nn1C.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H28N3.C2F6NO4S2/c1-4-6-7-8-9-10-11-12-13-18-14-15(5-2)17(3)16-18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h5,14H,2,4,6-13H2,1,3H3;/q+1;-1 |
| InChIKey | SJUXPKPRCVHTCZ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.56 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|