C17H27F9N4O4S2 — CID 10908041
bis(trifluoromethylsulfonyl)azanide;1-decyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium (PubChem CID 10908041) has the molecular formula C17H27F9N4O4S2 and a molecular weight of 586.54 g/mol. Its IUPAC name is bis(trifluoromethylsulfonyl)azanide;1-decyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium.
| Compound Name | bis(trifluoromethylsulfonyl)azanide;1-decyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 10908041 |
| Molecular Formula | C17H27F9N4O4S2 |
| Molecular Weight | 586.54 g/mol |
| Exact Mass | 586.13 |
| IUPAC Name | bis(trifluoromethylsulfonyl)azanide;1-decyl-4-(3,3,3-trifluoropropyl)-1,2,4-triazol-4-ium |
| SMILES | CCCCCCCCCCn1c[n+](CCC(F)(F)F)cn1.O=S(=O)([N-]S(=O)(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H27F3N3.C2F6NO4S2/c1-2-3-4-5-6-7-8-9-11-21-14-20(13-19-21)12-10-15(16,17)18;3-1(4,5)14(10,11)9-15(12,13)2(6,7)8/h13-14H,2-12H2,1H3;/q+1;-1 |
| InChIKey | YPYIQVYHZYKLGF-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 104.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.54 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|