C8H14F3N3O3S — CID 71663910
1-butyl-4-methyl-1,2,4-triazol-4-ium;trifluoromethanesulfonate (PubChem CID 71663910) has the molecular formula C8H14F3N3O3S and a molecular weight of 289.28 g/mol. Its IUPAC name is 1-butyl-4-methyl-1,2,4-triazol-4-ium;trifluoromethanesulfonate.
| Compound Name | 1-butyl-4-methyl-1,2,4-triazol-4-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 71663910 |
| Molecular Formula | C8H14F3N3O3S |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 1-butyl-4-methyl-1,2,4-triazol-4-ium;trifluoromethanesulfonate |
| SMILES | CCCCn1c[n+](C)cn1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C7H14N3.CHF3O3S/c1-3-4-5-10-7-9(2)6-8-10;2-1(3,4)8(5,6)7/h6-7H,3-5H2,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | YVBBWTZVAWMJQB-UHFFFAOYSA-M |
| XLogP | 0.56 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.28 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|