C15H27F3N3O+ — CID 102355305
3-(1-decyl-1,2,4-triazol-4-ium-4-yl)-1,1,1-trifluoropropan-2-ol (PubChem CID 102355305) has the molecular formula C15H27F3N3O+ and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-(1-decyl-1,2,4-triazol-4-ium-4-yl)-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-(1-decyl-1,2,4-triazol-4-ium-4-yl)-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 102355305 |
| Molecular Formula | C15H27F3N3O+ |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 3-(1-decyl-1,2,4-triazol-4-ium-4-yl)-1,1,1-trifluoropropan-2-ol |
| SMILES | CCCCCCCCCCn1c[n+](CC(O)C(F)(F)F)cn1 |
| InChI | InChI=1S/C15H27F3N3O/c1-2-3-4-5-6-7-8-9-10-21-13-20(12-19-21)11-14(22)15(16,17)18/h12-14,22H,2-11H2,1H3/q+1 |
| InChIKey | GQMAZQSWHVTDGT-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|