C14H20N3+ — CID 91809619
1-butyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium (PubChem CID 91809619) has the molecular formula C14H20N3+ and a molecular weight of 230.34 g/mol. Its IUPAC name is 1-butyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium.
| Compound Name | 1-butyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 91809619 |
| Molecular Formula | C14H20N3+ |
| Molecular Weight | 230.34 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 1-butyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium |
| SMILES | CCCCn1c[n+](Cc2ccccc2C)cn1 |
| InChI | InChI=1S/C14H20N3/c1-3-4-9-17-12-16(11-15-17)10-14-8-6-5-7-13(14)2/h5-8,11-12H,3-4,9-10H2,1-2H3/q+1 |
| InChIKey | JDHLYIUIOKNQAV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|