C18H27F9N3+ — CID 156599995
4-decyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium (PubChem CID 156599995) has the molecular formula C18H27F9N3+ and a molecular weight of 456.42 g/mol. Its IUPAC name is 4-decyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium.
| Compound Name | 4-decyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 156599995 |
| Molecular Formula | C18H27F9N3+ |
| Molecular Weight | 456.42 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | 4-decyl-1-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)-1,2,4-triazol-4-ium |
| SMILES | CCCCCCCCCC[n+]1cnn(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1 |
| InChI | InChI=1S/C18H27F9N3/c1-2-3-4-5-6-7-8-9-11-29-13-28-30(14-29)12-10-15(19,20)16(21,22)17(23,24)18(25,26)27/h13-14H,2-12H2,1H3/q+1 |
| InChIKey | AEPGXQFCKSTJDJ-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.42 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|