C10H20N3O3S+ — CID 102355302
4-(1-butyl-1,2,4-triazol-4-ium-4-yl)butane-1-sulfonic acid (PubChem CID 102355302) has the molecular formula C10H20N3O3S+ and a molecular weight of 262.35 g/mol. Its IUPAC name is 4-(1-butyl-1,2,4-triazol-4-ium-4-yl)butane-1-sulfonic acid.
| Compound Name | 4-(1-butyl-1,2,4-triazol-4-ium-4-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 102355302 |
| Molecular Formula | C10H20N3O3S+ |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-(1-butyl-1,2,4-triazol-4-ium-4-yl)butane-1-sulfonic acid |
| SMILES | CCCCn1c[n+](CCCCS(=O)(=O)O)cn1 |
| InChI | InChI=1S/C10H19N3O3S/c1-2-3-7-13-10-12(9-11-13)6-4-5-8-17(14,15)16/h9-10H,2-8H2,1H3/p+1 |
| InChIKey | ISCXHEAAKMXLOZ-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|