C13H27N3O3S+2 — CID 102355296
4-(2-heptyl-1H-1,2,4-triazole-2,4-diium-4-yl)butane-1-sulfonic acid (PubChem CID 102355296) has the molecular formula C13H27N3O3S+2 and a molecular weight of 305.44 g/mol. Its IUPAC name is 4-(2-heptyl-1H-1,2,4-triazole-2,4-diium-4-yl)butane-1-sulfonic acid.
| Compound Name | 4-(2-heptyl-1H-1,2,4-triazole-2,4-diium-4-yl)butane-1-sulfonic acid |
|---|---|
| PubChem CID | 102355296 |
| Molecular Formula | C13H27N3O3S+2 |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.18 |
| IUPAC Name | 4-(2-heptyl-1H-1,2,4-triazole-2,4-diium-4-yl)butane-1-sulfonic acid |
| SMILES | CCCCCCC[n+]1c[n+](CCCCS(=O)(=O)O)c[nH]1 |
| InChI | InChI=1S/C13H25N3O3S/c1-2-3-4-5-6-10-16-13-15(12-14-16)9-7-8-11-20(17,18)19/h12-13H,2-11H2,1H3/p+2 |
| InChIKey | TXKWDUJMUPSQII-UHFFFAOYSA-P |
| XLogP | 1.23 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|