C10H21N4+ — CID 102465882
1-octyl-1,2,4-triazol-4-ium-4-amine (PubChem CID 102465882) has the molecular formula C10H21N4+ and a molecular weight of 197.31 g/mol. Its IUPAC name is 1-octyl-1,2,4-triazol-4-ium-4-amine.
| Compound Name | 1-octyl-1,2,4-triazol-4-ium-4-amine |
|---|---|
| PubChem CID | 102465882 |
| Molecular Formula | C10H21N4+ |
| Molecular Weight | 197.31 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 1-octyl-1,2,4-triazol-4-ium-4-amine |
| SMILES | CCCCCCCCn1c[n+](N)cn1 |
| InChI | InChI=1S/C10H21N4/c1-2-3-4-5-6-7-8-14-10-13(11)9-12-14/h9-10H,2-8,11H2,1H3/q+1 |
| InChIKey | UUJFZIAQNHWEJQ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|