C13H17N4O+ — CID 574178
N-(1-butyl-1,2,4-triazol-4-ium-4-yl)benzamide (PubChem CID 574178) has the molecular formula C13H17N4O+ and a molecular weight of 245.31 g/mol. Its IUPAC name is N-(1-butyl-1,2,4-triazol-4-ium-4-yl)benzamide.
| Compound Name | N-(1-butyl-1,2,4-triazol-4-ium-4-yl)benzamide |
|---|---|
| PubChem CID | 574178 |
| Molecular Formula | C13H17N4O+ |
| Molecular Weight | 245.31 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-(1-butyl-1,2,4-triazol-4-ium-4-yl)benzamide |
| SMILES | CCCCn1c[n+](NC(=O)c2ccccc2)cn1 |
| InChI | InChI=1S/C13H16N4O/c1-2-3-9-16-11-17(10-14-16)15-13(18)12-7-5-4-6-8-12/h4-8,10-11H,2-3,9H2,1H3/p+1 |
| InChIKey | WAJCQDBXVLSVLE-UHFFFAOYSA-O |
| XLogP | 1.35 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|