C14H20ClN3 — CID 146109962
4-benzyl-1-pentyl-1,2,4-triazol-4-ium chloride (PubChem CID 146109962) has the molecular formula C14H20ClN3 and a molecular weight of 265.79 g/mol. Its IUPAC name is 4-benzyl-1-pentyl-1,2,4-triazol-4-ium chloride.
| Compound Name | 4-benzyl-1-pentyl-1,2,4-triazol-4-ium chloride |
|---|---|
| PubChem CID | 146109962 |
| Molecular Formula | C14H20ClN3 |
| Molecular Weight | 265.79 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | 4-benzyl-1-pentyl-1,2,4-triazol-4-ium chloride |
| SMILES | CCCCCn1c[n+](Cc2ccccc2)cn1.[Cl-] |
| InChI | InChI=1S/C14H20N3.ClH/c1-2-3-7-10-17-13-16(12-15-17)11-14-8-5-4-6-9-14;/h4-6,8-9,12-13H,2-3,7,10-11H2,1H3;1H/q+1;/p-1 |
| InChIKey | VYDWLRLHFJZSCC-UHFFFAOYSA-M |
| XLogP | -0.59 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.79 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|