C12H16N3+ — CID 91824699
1-ethyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium (PubChem CID 91824699) has the molecular formula C12H16N3+ and a molecular weight of 202.28 g/mol. Its IUPAC name is 1-ethyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium.
| Compound Name | 1-ethyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 91824699 |
| Molecular Formula | C12H16N3+ |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | 1-ethyl-4-[(2-methylphenyl)methyl]-1,2,4-triazol-4-ium |
| SMILES | CCn1c[n+](Cc2ccccc2C)cn1 |
| InChI | InChI=1S/C12H16N3/c1-3-15-10-14(9-13-15)8-12-7-5-4-6-11(12)2/h4-7,9-10H,3,8H2,1-2H3/q+1 |
| InChIKey | IPOAWTRWOZVCIU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|