C18H20N3+ — CID 91824723
4-[(2-methylphenyl)methyl]-1-[(4-methylphenyl)methyl]-1,2,4-triazol-4-ium (PubChem CID 91824723) has the molecular formula C18H20N3+ and a molecular weight of 278.38 g/mol. Its IUPAC name is 4-[(2-methylphenyl)methyl]-1-[(4-methylphenyl)methyl]-1,2,4-triazol-4-ium.
| Compound Name | 4-[(2-methylphenyl)methyl]-1-[(4-methylphenyl)methyl]-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 91824723 |
| Molecular Formula | C18H20N3+ |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 4-[(2-methylphenyl)methyl]-1-[(4-methylphenyl)methyl]-1,2,4-triazol-4-ium |
| SMILES | Cc1ccc(Cn2c[n+](Cc3ccccc3C)cn2)cc1 |
| InChI | InChI=1S/C18H20N3/c1-15-7-9-17(10-8-15)11-21-14-20(13-19-21)12-18-6-4-3-5-16(18)2/h3-10,13-14H,11-12H2,1-2H3/q+1 |
| InChIKey | HWNVXFWJTGXQHX-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|