C17H18N3+ — CID 134122531
4-methyl-1-[(4-methylphenyl)methyl]-3-phenyl-1,2,4-triazol-4-ium (PubChem CID 134122531) has the molecular formula C17H18N3+ and a molecular weight of 264.35 g/mol. Its IUPAC name is 4-methyl-1-[(4-methylphenyl)methyl]-3-phenyl-1,2,4-triazol-4-ium.
| Compound Name | 4-methyl-1-[(4-methylphenyl)methyl]-3-phenyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 134122531 |
| Molecular Formula | C17H18N3+ |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-methyl-1-[(4-methylphenyl)methyl]-3-phenyl-1,2,4-triazol-4-ium |
| SMILES | Cc1ccc(Cn2c[n+](C)c(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C17H18N3/c1-14-8-10-15(11-9-14)12-20-13-19(2)17(18-20)16-6-4-3-5-7-16/h3-11,13H,12H2,1-2H3/q+1 |
| InChIKey | NQSGLBAXGGSGBB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|