C16H14ClFN3+ — CID 134121280
3-(3-chlorophenyl)-1-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-4-ium (PubChem CID 134121280) has the molecular formula C16H14ClFN3+ and a molecular weight of 302.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-4-ium.
| Compound Name | 3-(3-chlorophenyl)-1-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 134121280 |
| Molecular Formula | C16H14ClFN3+ |
| Molecular Weight | 302.76 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 3-(3-chlorophenyl)-1-[(3-fluorophenyl)methyl]-4-methyl-1,2,4-triazol-4-ium |
| SMILES | C[n+]1cn(Cc2cccc(F)c2)nc1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H14ClFN3/c1-20-11-21(10-12-4-2-7-15(18)8-12)19-16(20)13-5-3-6-14(17)9-13/h2-9,11H,10H2,1H3/q+1 |
| InChIKey | UFYJLWGOAKNVJB-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.76 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|