C9H7FIN3 — CID 79784814
1-[(3-fluorophenyl)methyl]-3-iodo-1,2,4-triazole (PubChem CID 79784814) has the molecular formula C9H7FIN3 and a molecular weight of 303.08 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-3-iodo-1,2,4-triazole.
| Compound Name | 1-[(3-fluorophenyl)methyl]-3-iodo-1,2,4-triazole |
|---|---|
| PubChem CID | 79784814 |
| Molecular Formula | C9H7FIN3 |
| Molecular Weight | 303.08 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-3-iodo-1,2,4-triazole |
| SMILES | Fc1cccc(Cn2cnc(I)n2)c1 |
| InChI | InChI=1S/C9H7FIN3/c10-8-3-1-2-7(4-8)5-14-6-12-9(11)13-14/h1-4,6H,5H2 |
| InChIKey | YFJWHCSDEFTRBG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.08 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|