C9H6F2IN3 — CID 105411294
1-[(3,5-difluorophenyl)methyl]-3-iodo-1,2,4-triazole (PubChem CID 105411294) has the molecular formula C9H6F2IN3 and a molecular weight of 321.07 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-3-iodo-1,2,4-triazole.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-3-iodo-1,2,4-triazole |
|---|---|
| PubChem CID | 105411294 |
| Molecular Formula | C9H6F2IN3 |
| Molecular Weight | 321.07 g/mol |
| Exact Mass | 320.96 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-3-iodo-1,2,4-triazole |
| SMILES | Fc1cc(F)cc(Cn2cnc(I)n2)c1 |
| InChI | InChI=1S/C9H6F2IN3/c10-7-1-6(2-8(11)3-7)4-15-5-13-9(12)14-15/h1-3,5H,4H2 |
| InChIKey | JVEJMVCHEVLGDB-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.07 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|