C16H12F2N4O2 — CID 171344502
4-[[3-(3,5-difluorophenyl)-1,2,4-triazol-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 171344502) has the molecular formula C16H12F2N4O2 and a molecular weight of 330.29 g/mol. Its IUPAC name is 4-[[3-(3,5-difluorophenyl)-1,2,4-triazol-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[3-(3,5-difluorophenyl)-1,2,4-triazol-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 171344502 |
| Molecular Formula | C16H12F2N4O2 |
| Molecular Weight | 330.29 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-[[3-(3,5-difluorophenyl)-1,2,4-triazol-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(Cn2cnc(-c3cc(F)cc(F)c3)n2)cc1 |
| InChI | InChI=1S/C16H12F2N4O2/c17-13-5-12(6-14(18)7-13)15-19-9-22(20-15)8-10-1-3-11(4-2-10)16(23)21-24/h1-7,9,24H,8H2,(H,21,23) |
| InChIKey | DNGDWRMDZHYPCT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|