C10H8F2N4O — CID 145225019
1-[(3,5-difluorophenyl)methyl]-1,2,4-triazole-3-carboxamide (PubChem CID 145225019) has the molecular formula C10H8F2N4O and a molecular weight of 238.20 g/mol. Its IUPAC name is 1-[(3,5-difluorophenyl)methyl]-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[(3,5-difluorophenyl)methyl]-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 145225019 |
| Molecular Formula | C10H8F2N4O |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | 1-[(3,5-difluorophenyl)methyl]-1,2,4-triazole-3-carboxamide |
| SMILES | NC(=O)c1ncn(Cc2cc(F)cc(F)c2)n1 |
| InChI | InChI=1S/C10H8F2N4O/c11-7-1-6(2-8(12)3-7)4-16-5-14-10(15-16)9(13)17/h1-3,5H,4H2,(H2,13,17) |
| InChIKey | JLMHHONTXGDFNX-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |