C11H8FI2N3S — CID 114272432
3-[(4,5-diiodoimidazol-1-yl)methyl]-5-fluorobenzenecarbothioamide (PubChem CID 114272432) has the molecular formula C11H8FI2N3S and a molecular weight of 487.08 g/mol. Its IUPAC name is 3-[(4,5-diiodoimidazol-1-yl)methyl]-5-fluorobenzenecarbothioamide.
| Compound Name | 3-[(4,5-diiodoimidazol-1-yl)methyl]-5-fluorobenzenecarbothioamide |
|---|---|
| PubChem CID | 114272432 |
| Molecular Formula | C11H8FI2N3S |
| Molecular Weight | 487.08 g/mol |
| Exact Mass | 486.85 |
| IUPAC Name | 3-[(4,5-diiodoimidazol-1-yl)methyl]-5-fluorobenzenecarbothioamide |
| SMILES | NC(=S)c1cc(F)cc(Cn2cnc(I)c2I)c1 |
| InChI | InChI=1S/C11H8FI2N3S/c12-8-2-6(1-7(3-8)11(15)18)4-17-5-16-9(13)10(17)14/h1-3,5H,4H2,(H2,15,18) |
| InChIKey | KBUBPKPIBMNWPQ-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.08 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|