C10H11ClN3+ — CID 134121284
3-(3-chlorophenyl)-1,4-dimethyl-1,2,4-triazol-4-ium (PubChem CID 134121284) has the molecular formula C10H11ClN3+ and a molecular weight of 208.67 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-1,4-dimethyl-1,2,4-triazol-4-ium.
| Compound Name | 3-(3-chlorophenyl)-1,4-dimethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 134121284 |
| Molecular Formula | C10H11ClN3+ |
| Molecular Weight | 208.67 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 3-(3-chlorophenyl)-1,4-dimethyl-1,2,4-triazol-4-ium |
| SMILES | Cn1c[n+](C)c(-c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C10H11ClN3/c1-13-7-14(2)12-10(13)8-4-3-5-9(11)6-8/h3-7H,1-2H3/q+1 |
| InChIKey | AYUWPLOBGYNATR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.67 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|