C11H10ClF3N3O+ — CID 123237456
3-[3-chloro-5-(trifluoromethoxy)phenyl]-1,4-dimethyl-1,2,4-triazol-4-ium (PubChem CID 123237456) has the molecular formula C11H10ClF3N3O+ and a molecular weight of 292.67 g/mol. Its IUPAC name is 3-[3-chloro-5-(trifluoromethoxy)phenyl]-1,4-dimethyl-1,2,4-triazol-4-ium.
| Compound Name | 3-[3-chloro-5-(trifluoromethoxy)phenyl]-1,4-dimethyl-1,2,4-triazol-4-ium |
|---|---|
| PubChem CID | 123237456 |
| Molecular Formula | C11H10ClF3N3O+ |
| Molecular Weight | 292.67 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 3-[3-chloro-5-(trifluoromethoxy)phenyl]-1,4-dimethyl-1,2,4-triazol-4-ium |
| SMILES | Cn1c[n+](C)c(-c2cc(Cl)cc(OC(F)(F)F)c2)n1 |
| InChI | InChI=1S/C11H10ClF3N3O/c1-17-6-18(2)16-10(17)7-3-8(12)5-9(4-7)19-11(13,14)15/h3-6H,1-2H3/q+1 |
| InChIKey | PYLHMURFTSMBHW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.67 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|