C15H14ClF3N3O3+ — CID 76806709
propan-2-yl 3-[5-[3-chloro-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-2-ium-2-yl]prop-2-enoate (PubChem CID 76806709) has the molecular formula C15H14ClF3N3O3+ and a molecular weight of 376.74 g/mol. Its IUPAC name is propan-2-yl 3-[5-[3-chloro-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-2-ium-2-yl]prop-2-enoate.
| Compound Name | propan-2-yl 3-[5-[3-chloro-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-2-ium-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 76806709 |
| Molecular Formula | C15H14ClF3N3O3+ |
| Molecular Weight | 376.74 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | propan-2-yl 3-[5-[3-chloro-5-(trifluoromethoxy)phenyl]-1H-1,2,4-triazol-2-ium-2-yl]prop-2-enoate |
| SMILES | CC(C)OC(=O)C=C[n+]1cnc(-c2cc(Cl)cc(OC(F)(F)F)c2)[nH]1 |
| InChI | InChI=1S/C15H13ClF3N3O3/c1-9(2)24-13(23)3-4-22-8-20-14(21-22)10-5-11(16)7-12(6-10)25-15(17,18)19/h3-9H,1-2H3/p+1 |
| InChIKey | HWVQEPCTSFAUCT-UHFFFAOYSA-O |
| XLogP | 3.34 |
| TPSA | 68.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.74 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|