C15H17N6+ — CID 134087743
2-methyl-5-[(4-methyl-3-phenyl-1,2,4-triazol-4-ium-1-yl)methyl]pyrimidin-4-amine (PubChem CID 134087743) has the molecular formula C15H17N6+ and a molecular weight of 281.34 g/mol. Its IUPAC name is 2-methyl-5-[(4-methyl-3-phenyl-1,2,4-triazol-4-ium-1-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-5-[(4-methyl-3-phenyl-1,2,4-triazol-4-ium-1-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 134087743 |
| Molecular Formula | C15H17N6+ |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 2-methyl-5-[(4-methyl-3-phenyl-1,2,4-triazol-4-ium-1-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1ncc(Cn2c[n+](C)c(-c3ccccc3)n2)c(N)n1 |
| InChI | InChI=1S/C15H17N6/c1-11-17-8-13(14(16)18-11)9-21-10-20(2)15(19-21)12-6-4-3-5-7-12/h3-8,10H,9H2,1-2H3,(H2,16,17,18)/q+1 |
| InChIKey | BTBXNKAWXHBGGW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 73.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|