About trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride
trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride (PubChem CID 173304149) has the molecular formula C6H12N3Na3O
and a molecular weight of 211.15 g/mol. Its IUPAC name is trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride.
Molecular Properties
| Compound Name | trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride |
| PubChem CID | 173304149 |
| Molecular Formula | C6H12N3Na3O |
| Molecular Weight | 211.15 g/mol |
| Exact Mass | 211.07 |
| IUPAC Name | trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride |
| SMILES | Cc1ncc(CO)c(N)n1.[H-].[H-].[H-].[Na+].[Na+].[Na+] |
| InChI | InChI=1S/C6H9N3O.3Na.3H/c1-4-8-2-5(3-10)6(7)9-4;;;;;;/h2,10H,3H2,1H3,(H2,7,8,9);;;;;;/q;3*+1;3*-1 |
| InChIKey | ZEIIVUWIKHUGCN-UHFFFAOYSA-N |
| XLogP | -8.79 |
| TPSA | 72.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.15 |
| LogP ≤ 5 | -8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride?
The IUPAC name of trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride (CID 173304149) is trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride.
What is the SMILES notation for trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride?
The canonical SMILES for trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride is Cc1ncc(CO)c(N)n1.[H-].[H-].[H-].[Na+].[Na+].[Na+].
What is the InChIKey of trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride?
The InChIKey is ZEIIVUWIKHUGCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O.3Na.3H/c1-4-8-2-5(3-10)6(7)9-4;;;;;;/h2,10H,3H2,1H3,(H2,7,8,9);;;;;;/q;3*+1;3*-1.
What are the key properties of trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride?
trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride has a molecular weight of 211.15 g/mol, XLogP of -8.79, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for trisodium;(4-amino-2-methylpyrimidin-5-yl)methanol;hydride is sourced from PubChem (CID 173304149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).