C6H11N3O7P2 — CID 217
(4-amino-2-methylpyrimidin-5-yl)methyl phosphono hydrogen phosphate (PubChem CID 217) has the molecular formula C6H11N3O7P2 and a molecular weight of 299.12 g/mol. Its IUPAC name is (4-amino-2-methylpyrimidin-5-yl)methyl phosphono hydrogen phosphate.
| Compound Name | (4-amino-2-methylpyrimidin-5-yl)methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 217 |
| Molecular Formula | C6H11N3O7P2 |
| Molecular Weight | 299.12 g/mol |
| Exact Mass | 299.01 |
| IUPAC Name | (4-amino-2-methylpyrimidin-5-yl)methyl phosphono hydrogen phosphate |
| SMILES | Cc1ncc(COP(=O)(O)OP(=O)(O)O)c(N)n1 |
| InChI | InChI=1S/C6H11N3O7P2/c1-4-8-2-5(6(7)9-4)3-15-18(13,14)16-17(10,11)12/h2H,3H2,1H3,(H,13,14)(H2,7,8,9)(H2,10,11,12) |
| InChIKey | AGQJQCFEPUVXNK-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 165.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.12 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|