C14H14N5S+ — CID 163502650
2-methyl-5-[(5-phenyl-1,3,4-thiadiazol-3-ium-3-yl)methyl]pyrimidin-4-amine (PubChem CID 163502650) has the molecular formula C14H14N5S+ and a molecular weight of 284.37 g/mol. Its IUPAC name is 2-methyl-5-[(5-phenyl-1,3,4-thiadiazol-3-ium-3-yl)methyl]pyrimidin-4-amine.
| Compound Name | 2-methyl-5-[(5-phenyl-1,3,4-thiadiazol-3-ium-3-yl)methyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 163502650 |
| Molecular Formula | C14H14N5S+ |
| Molecular Weight | 284.37 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 2-methyl-5-[(5-phenyl-1,3,4-thiadiazol-3-ium-3-yl)methyl]pyrimidin-4-amine |
| SMILES | Cc1ncc(C[n+]2csc(-c3ccccc3)n2)c(N)n1 |
| InChI | InChI=1S/C14H14N5S/c1-10-16-7-12(13(15)17-10)8-19-9-20-14(18-19)11-5-3-2-4-6-11/h2-7,9H,8H2,1H3,(H2,15,16,17)/q+1 |
| InChIKey | NFHBPGDOQAVVMK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|