C14H23N4S+ — CID 176696031
ethane;5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-2-methylpyrimidin-4-amine (PubChem CID 176696031) has the molecular formula C14H23N4S+ and a molecular weight of 279.43 g/mol. Its IUPAC name is ethane;5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-2-methylpyrimidin-4-amine.
| Compound Name | ethane;5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-2-methylpyrimidin-4-amine |
|---|---|
| PubChem CID | 176696031 |
| Molecular Formula | C14H23N4S+ |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | ethane;5-[(5-ethyl-4-methyl-1,3-thiazol-3-ium-3-yl)methyl]-2-methylpyrimidin-4-amine |
| SMILES | CC.CCc1sc[n+](Cc2cnc(C)nc2N)c1C |
| InChI | InChI=1S/C12H17N4S.C2H6/c1-4-11-8(2)16(7-17-11)6-10-5-14-9(3)15-12(10)13;1-2/h5,7H,4,6H2,1-3H3,(H2,13,14,15);1-2H3/q+1; |
| InChIKey | LIBGUVFWDCTULX-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|