C12H21Cl2N4O5PS — CID 21116077
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;phosphoric acid;chloride;hydrochloride (PubChem CID 21116077) has the molecular formula C12H21Cl2N4O5PS and a molecular weight of 435.27 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;phosphoric acid;chloride;hydrochloride.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;phosphoric acid;chloride;hydrochloride |
|---|---|
| PubChem CID | 21116077 |
| Molecular Formula | C12H21Cl2N4O5PS |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.03 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethanol;phosphoric acid;chloride;hydrochloride |
| SMILES | Cc1ncc(C[n+]2csc(CCO)c2C)c(N)n1.Cl.O=P(O)(O)O.[Cl-] |
| InChI | InChI=1S/C12H17N4OS.2ClH.H3O4P/c1-8-11(3-4-17)18-7-16(8)6-10-5-14-9(2)15-12(10)13;;;1-5(2,3)4/h5,7,17H,3-4,6H2,1-2H3,(H2,13,14,15);2*1H;(H3,1,2,3,4)/q+1;;;/p-1 |
| InChIKey | MZNQVFULLGBPJJ-UHFFFAOYSA-M |
| XLogP | -2.90 |
| TPSA | 153.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|