C13H17N4OS3+ — CID 175115357
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxymethanedithioic acid (PubChem CID 175115357) has the molecular formula C13H17N4OS3+ and a molecular weight of 341.51 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxymethanedithioic acid.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxymethanedithioic acid |
|---|---|
| PubChem CID | 175115357 |
| Molecular Formula | C13H17N4OS3+ |
| Molecular Weight | 341.51 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethoxymethanedithioic acid |
| SMILES | Cc1ncc(C[n+]2csc(CCOC(=S)S)c2C)c(N)n1 |
| InChI | InChI=1S/C13H16N4OS3/c1-8-11(3-4-18-13(19)20)21-7-17(8)6-10-5-15-9(2)16-12(10)14/h5,7H,3-4,6H2,1-2H3,(H2-,14,15,16,19,20)/p+1 |
| InChIKey | MIAUWDJYAXPZFI-UHFFFAOYSA-O |
| XLogP | 1.85 |
| TPSA | 64.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.51 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|