C8H11Br2N5S — CID 163921839
2-methyl-5-(1,3,4-thiadiazol-3-ium-3-ylmethyl)pyrimidin-4-amine;bromide;hydrobromide (PubChem CID 163921839) has the molecular formula C8H11Br2N5S and a molecular weight of 369.09 g/mol. Its IUPAC name is 2-methyl-5-(1,3,4-thiadiazol-3-ium-3-ylmethyl)pyrimidin-4-amine;bromide;hydrobromide.
| Compound Name | 2-methyl-5-(1,3,4-thiadiazol-3-ium-3-ylmethyl)pyrimidin-4-amine;bromide;hydrobromide |
|---|---|
| PubChem CID | 163921839 |
| Molecular Formula | C8H11Br2N5S |
| Molecular Weight | 369.09 g/mol |
| Exact Mass | 366.91 |
| IUPAC Name | 2-methyl-5-(1,3,4-thiadiazol-3-ium-3-ylmethyl)pyrimidin-4-amine;bromide;hydrobromide |
| SMILES | Br.Cc1ncc(C[n+]2cscn2)c(N)n1.[Br-] |
| InChI | InChI=1S/C8H10N5S.2BrH/c1-6-10-2-7(8(9)12-6)3-13-5-14-4-11-13;;/h2,4-5H,3H2,1H3,(H2,9,10,12);2*1H/q+1;;/p-1 |
| InChIKey | RBBGLMFXNAWUJD-UHFFFAOYSA-M |
| XLogP | -2.26 |
| TPSA | 68.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.09 |
| LogP ≤ 5 | -2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|