C24H26BN4O3S+ — CID 91152403
2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl diphenyl borate (PubChem CID 91152403) has the molecular formula C24H26BN4O3S+ and a molecular weight of 461.38 g/mol. Its IUPAC name is 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl diphenyl borate.
| Compound Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl diphenyl borate |
|---|---|
| PubChem CID | 91152403 |
| Molecular Formula | C24H26BN4O3S+ |
| Molecular Weight | 461.38 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 2-[3-[(4-amino-2-methylpyrimidin-5-yl)methyl]-4-methyl-1,3-thiazol-3-ium-5-yl]ethyl diphenyl borate |
| SMILES | Cc1ncc(C[n+]2csc(CCOB(Oc3ccccc3)Oc3ccccc3)c2C)c(N)n1 |
| InChI | InChI=1S/C24H26BN4O3S/c1-18-23(33-17-29(18)16-20-15-27-19(2)28-24(20)26)13-14-30-25(31-21-9-5-3-6-10-21)32-22-11-7-4-8-12-22/h3-12,15,17H,13-14,16H2,1-2H3,(H2,26,27,28)/q+1 |
| InChIKey | FZSDYYGTKQXSDK-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|