C39H56O2S — CID 158720761
phenyl-bis(2,4,6-tripropylphenyl)sulfanium;propanoate (PubChem CID 158720761) has the molecular formula C39H56O2S and a molecular weight of 588.94 g/mol. Its IUPAC name is phenyl-bis(2,4,6-tripropylphenyl)sulfanium;propanoate.
| Compound Name | phenyl-bis(2,4,6-tripropylphenyl)sulfanium;propanoate |
|---|---|
| PubChem CID | 158720761 |
| Molecular Formula | C39H56O2S |
| Molecular Weight | 588.94 g/mol |
| Exact Mass | 588.40 |
| IUPAC Name | phenyl-bis(2,4,6-tripropylphenyl)sulfanium;propanoate |
| SMILES | CCC(=O)[O-].CCCc1cc(CCC)c([S+](c2ccccc2)c2c(CCC)cc(CCC)cc2CCC)c(CCC)c1 |
| InChI | InChI=1S/C36H51S.C3H6O2/c1-7-16-28-24-30(18-9-3)35(31(25-28)19-10-4)37(34-22-14-13-15-23-34)36-32(20-11-5)26-29(17-8-2)27-33(36)21-12-6;1-2-3(4)5/h13-15,22-27H,7-12,16-21H2,1-6H3;2H2,1H3,(H,4,5)/q+1;/p-1 |
| InChIKey | IJWQCJOIFYOBGR-UHFFFAOYSA-M |
| XLogP | 9.64 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.94 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|