C44H66O8S — CID 159841211
phenyl-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium acetate (PubChem CID 159841211) has the molecular formula C44H66O8S and a molecular weight of 755.07 g/mol. Its IUPAC name is phenyl-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium acetate.
| Compound Name | phenyl-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium acetate |
|---|---|
| PubChem CID | 159841211 |
| Molecular Formula | C44H66O8S |
| Molecular Weight | 755.07 g/mol |
| Exact Mass | 754.45 |
| IUPAC Name | phenyl-bis[2,4,6-tris[(2-methylpropan-2-yl)oxy]phenyl]sulfanium acetate |
| SMILES | CC(=O)[O-].CC(C)(C)Oc1cc(OC(C)(C)C)c([S+](c2ccccc2)c2c(OC(C)(C)C)cc(OC(C)(C)C)cc2OC(C)(C)C)c(OC(C)(C)C)c1 |
| InChI | InChI=1S/C42H63O6S.C2H4O2/c1-37(2,3)43-28-24-31(45-39(7,8)9)35(32(25-28)46-40(10,11)12)49(30-22-20-19-21-23-30)36-33(47-41(13,14)15)26-29(44-38(4,5)6)27-34(36)48-42(16,17)18;1-2(3)4/h19-27H,1-18H3;1H3,(H,3,4)/q+1;/p-1 |
| InChIKey | UBGHOEXUXSLHBA-UHFFFAOYSA-M |
| XLogP | 10.60 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 755.07 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|