C22H21O3S+ — CID 164747017
(4-hydroxy-3,5-dimethylphenyl)-(4-methoxycarbonylphenyl)-phenylsulfanium (PubChem CID 164747017) has the molecular formula C22H21O3S+ and a molecular weight of 365.47 g/mol. Its IUPAC name is (4-hydroxy-3,5-dimethylphenyl)-(4-methoxycarbonylphenyl)-phenylsulfanium.
| Compound Name | (4-hydroxy-3,5-dimethylphenyl)-(4-methoxycarbonylphenyl)-phenylsulfanium |
|---|---|
| PubChem CID | 164747017 |
| Molecular Formula | C22H21O3S+ |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | (4-hydroxy-3,5-dimethylphenyl)-(4-methoxycarbonylphenyl)-phenylsulfanium |
| SMILES | COC(=O)c1ccc([S+](c2ccccc2)c2cc(C)c(O)c(C)c2)cc1 |
| InChI | InChI=1S/C22H20O3S/c1-15-13-20(14-16(2)21(15)23)26(18-7-5-4-6-8-18)19-11-9-17(10-12-19)22(24)25-3/h4-14H,1-3H3/p+1 |
| InChIKey | WJZZGPLZWYPKTR-UHFFFAOYSA-O |
| XLogP | 4.89 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|