About potassium;tris(4-methylphenyl) phosphate;hydroxide
potassium;tris(4-methylphenyl) phosphate;hydroxide (PubChem CID 174496858) has the molecular formula C21H22KO5P
and a molecular weight of 424.47 g/mol. Its IUPAC name is potassium;tris(4-methylphenyl) phosphate;hydroxide.
Molecular Properties
| Compound Name | potassium;tris(4-methylphenyl) phosphate;hydroxide |
| PubChem CID | 174496858 |
| Molecular Formula | C21H22KO5P |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | potassium;tris(4-methylphenyl) phosphate;hydroxide |
| SMILES | Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.[K+].[OH-] |
| InChI | InChI=1S/C21H21O4P.K.H2O/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21;;/h4-15H,1-3H3;;1H2/q;+1;/p-1 |
| InChIKey | AGMATASWCBLDBG-UHFFFAOYSA-M |
| XLogP | 3.08 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze potassium;tris(4-methylphenyl) phosphate;hydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;tris(4-methylphenyl) phosphate;hydroxide?
The IUPAC name of potassium;tris(4-methylphenyl) phosphate;hydroxide (CID 174496858) is potassium;tris(4-methylphenyl) phosphate;hydroxide.
What is the SMILES notation for potassium;tris(4-methylphenyl) phosphate;hydroxide?
The canonical SMILES for potassium;tris(4-methylphenyl) phosphate;hydroxide is Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.[K+].[OH-].
What is the InChIKey of potassium;tris(4-methylphenyl) phosphate;hydroxide?
The InChIKey is AGMATASWCBLDBG-UHFFFAOYSA-M. The full InChI is InChI=1S/C21H21O4P.K.H2O/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21;;/h4-15H,1-3H3;;1H2/q;+1;/p-1.
What are the key properties of potassium;tris(4-methylphenyl) phosphate;hydroxide?
potassium;tris(4-methylphenyl) phosphate;hydroxide has a molecular weight of 424.47 g/mol, XLogP of 3.08, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;tris(4-methylphenyl) phosphate;hydroxide is sourced from PubChem (CID 174496858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).