About [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium
[4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium (PubChem CID 91420416) has the molecular formula C37H31O7P2+
and a molecular weight of 649.60 g/mol. Its IUPAC name is [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium.
Molecular Properties
| Compound Name | [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium |
| PubChem CID | 91420416 |
| Molecular Formula | C37H31O7P2+ |
| Molecular Weight | 649.60 g/mol |
| Exact Mass | 649.15 |
| IUPAC Name | [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium |
| SMILES | Cc1ccc(-c2ccc(OP(=O)(Oc3ccccc3)Oc3ccccc3)cc2)cc1.O=[P+](Oc1ccccc1)Oc1ccccc1 |
| InChI | InChI=1S/C25H21O4P.C12H10O3P/c1-20-12-14-21(15-13-20)22-16-18-25(19-17-22)29-30(26,27-23-8-4-2-5-9-23)28-24-10-6-3-7-11-24;13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h2-19H,1H3;1-10H/q;+1 |
| InChIKey | ROQHIZVDFSCAMU-UHFFFAOYSA-N |
| XLogP | 11.11 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 649.60 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium?
The IUPAC name of [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium (CID 91420416) is [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium.
What is the SMILES notation for [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium?
The canonical SMILES for [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium is Cc1ccc(-c2ccc(OP(=O)(Oc3ccccc3)Oc3ccccc3)cc2)cc1.O=[P+](Oc1ccccc1)Oc1ccccc1.
What is the InChIKey of [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium?
The InChIKey is ROQHIZVDFSCAMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21O4P.C12H10O3P/c1-20-12-14-21(15-13-20)22-16-18-25(19-17-22)29-30(26,27-23-8-4-2-5-9-23)28-24-10-6-3-7-11-24;13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h2-19H,1H3;1-10H/q;+1.
What are the key properties of [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium?
[4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium has a molecular weight of 649.60 g/mol, XLogP of 11.11, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(4-methylphenyl)phenyl] diphenyl phosphate;oxo(diphenoxy)phosphanium is sourced from PubChem (CID 91420416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).