About (4-phenoxyphenyl) N-hydroxyethanimidate
(4-phenoxyphenyl) N-hydroxyethanimidate (PubChem CID 173403017) has the molecular formula C14H13NO3
and a molecular weight of 243.26 g/mol. Its IUPAC name is (4-phenoxyphenyl) N-hydroxyethanimidate.
Molecular Properties
| Compound Name | (4-phenoxyphenyl) N-hydroxyethanimidate |
| PubChem CID | 173403017 |
| Molecular Formula | C14H13NO3 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | (4-phenoxyphenyl) N-hydroxyethanimidate |
| SMILES | CC(=NO)Oc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C14H13NO3/c1-11(15-16)17-13-7-9-14(10-8-13)18-12-5-3-2-4-6-12/h2-10,16H,1H3 |
| InChIKey | MRTBCYYRXQALJP-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-phenoxyphenyl) N-hydroxyethanimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenoxyphenyl) N-hydroxyethanimidate?
The IUPAC name of (4-phenoxyphenyl) N-hydroxyethanimidate (CID 173403017) is (4-phenoxyphenyl) N-hydroxyethanimidate.
What is the SMILES notation for (4-phenoxyphenyl) N-hydroxyethanimidate?
The canonical SMILES for (4-phenoxyphenyl) N-hydroxyethanimidate is CC(=NO)Oc1ccc(Oc2ccccc2)cc1.
What is the InChIKey of (4-phenoxyphenyl) N-hydroxyethanimidate?
The InChIKey is MRTBCYYRXQALJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NO3/c1-11(15-16)17-13-7-9-14(10-8-13)18-12-5-3-2-4-6-12/h2-10,16H,1H3.
What are the key properties of (4-phenoxyphenyl) N-hydroxyethanimidate?
(4-phenoxyphenyl) N-hydroxyethanimidate has a molecular weight of 243.26 g/mol, XLogP of 3.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenoxyphenyl) N-hydroxyethanimidate is sourced from PubChem (CID 173403017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).