C28H30O3S — CID 143535110
1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-4-methylbenzene;1-methyl-4-(4-methylsulfonylphenyl)benzene (PubChem CID 143535110) has the molecular formula C28H30O3S and a molecular weight of 446.61 g/mol. Its IUPAC name is 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-4-methylbenzene;1-methyl-4-(4-methylsulfonylphenyl)benzene.
| Compound Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-4-methylbenzene;1-methyl-4-(4-methylsulfonylphenyl)benzene |
|---|---|
| PubChem CID | 143535110 |
| Molecular Formula | C28H30O3S |
| Molecular Weight | 446.61 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | 1-[(2E,4Z)-hepta-2,4,6-trien-3-yl]oxy-4-methylbenzene;1-methyl-4-(4-methylsulfonylphenyl)benzene |
| SMILES | C=C/C=C\C(=C/C)Oc1ccc(C)cc1.Cc1ccc(-c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C14H14O2S.C14H16O/c1-11-3-5-12(6-4-11)13-7-9-14(10-8-13)17(2,15)16;1-4-6-7-13(5-2)15-14-10-8-12(3)9-11-14/h3-10H,1-2H3;4-11H,1H2,2-3H3/b;7-6-,13-5+ |
| InChIKey | JTAZQABDSHCCLB-LKHLEVTDSA-N |
| XLogP | 7.09 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.61 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|