C28H30O4S — CID 142950692
1-[4-(4-buta-1,3-dien-2-yloxyphenyl)sulfonylphenoxy]-4-methylbenzene;2-methylbut-2-ene (PubChem CID 142950692) has the molecular formula C28H30O4S and a molecular weight of 462.61 g/mol. Its IUPAC name is 1-[4-(4-buta-1,3-dien-2-yloxyphenyl)sulfonylphenoxy]-4-methylbenzene;2-methylbut-2-ene.
| Compound Name | 1-[4-(4-buta-1,3-dien-2-yloxyphenyl)sulfonylphenoxy]-4-methylbenzene;2-methylbut-2-ene |
|---|---|
| PubChem CID | 142950692 |
| Molecular Formula | C28H30O4S |
| Molecular Weight | 462.61 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | 1-[4-(4-buta-1,3-dien-2-yloxyphenyl)sulfonylphenoxy]-4-methylbenzene;2-methylbut-2-ene |
| SMILES | C=CC(=C)Oc1ccc(S(=O)(=O)c2ccc(Oc3ccc(C)cc3)cc2)cc1.CC=C(C)C |
| InChI | InChI=1S/C23H20O4S.C5H10/c1-4-18(3)26-19-9-13-22(14-10-19)28(24,25)23-15-11-21(12-16-23)27-20-7-5-17(2)6-8-20;1-4-5(2)3/h4-16H,1,3H2,2H3;4H,1-3H3 |
| InChIKey | HTVJOXSHUOKFCZ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.61 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|