C15H20N2O2 — CID 142886746
(3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine (PubChem CID 142886746) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine.
| Compound Name | (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine |
|---|---|
| PubChem CID | 142886746 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine |
| SMILES | CNC.[H]/N=C(C=O)/C=C(\C=C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C13H13NO2.C2H7N/c1-3-12(8-11(14)9-15)16-13-6-4-10(2)5-7-13;1-3-2/h3-9,14H,1H2,2H3;3H,1-2H3/b12-8+,14-11-; |
| InChIKey | MPMBWJJWWDTGCU-WKPINRAWSA-N |
| XLogP | 2.50 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|