About (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine
(3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine (PubChem CID 142886746) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine.
Molecular Properties
| Compound Name | (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine |
| PubChem CID | 142886746 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine |
| SMILES | CNC.[H]/N=C(C=O)/C=C(\C=C)Oc1ccc(C)cc1 |
| InChI | InChI=1S/C13H13NO2.C2H7N/c1-3-12(8-11(14)9-15)16-13-6-4-10(2)5-7-13;1-3-2/h3-9,14H,1H2,2H3;3H,1-2H3/b12-8+,14-11-; |
| InChIKey | MPMBWJJWWDTGCU-WKPINRAWSA-N |
| XLogP | 2.50 |
| TPSA | 62.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine?
The IUPAC name of (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine (CID 142886746) is (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine.
What is the SMILES notation for (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine?
The canonical SMILES for (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine is CNC.[H]/N=C(C=O)/C=C(\C=C)Oc1ccc(C)cc1.
What is the InChIKey of (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine?
The InChIKey is MPMBWJJWWDTGCU-WKPINRAWSA-N. The full InChI is InChI=1S/C13H13NO2.C2H7N/c1-3-12(8-11(14)9-15)16-13-6-4-10(2)5-7-13;1-3-2/h3-9,14H,1H2,2H3;3H,1-2H3/b12-8+,14-11-;.
What are the key properties of (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine?
(3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine has a molecular weight of 260.34 g/mol, XLogP of 2.50, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3E)-2-imino-4-(4-methylphenoxy)hexa-3,5-dienal;N-methylmethanamine is sourced from PubChem (CID 142886746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).