C14H8O8 — CID 89374506
(4-methylphenyl) 2,3,4,5,6,7-hexaoxoheptanoate (PubChem CID 89374506) has the molecular formula C14H8O8 and a molecular weight of 304.21 g/mol. Its IUPAC name is (4-methylphenyl) 2,3,4,5,6,7-hexaoxoheptanoate.
| Compound Name | (4-methylphenyl) 2,3,4,5,6,7-hexaoxoheptanoate |
|---|---|
| PubChem CID | 89374506 |
| Molecular Formula | C14H8O8 |
| Molecular Weight | 304.21 g/mol |
| Exact Mass | 304.02 |
| IUPAC Name | (4-methylphenyl) 2,3,4,5,6,7-hexaoxoheptanoate |
| SMILES | Cc1ccc(OC(=O)C(=O)C(=O)C(=O)C(=O)C(=O)C=O)cc1 |
| InChI | InChI=1S/C14H8O8/c1-7-2-4-8(5-3-7)22-14(21)13(20)12(19)11(18)10(17)9(16)6-15/h2-6H,1H3 |
| InChIKey | IJIYYGVZCABBMW-UHFFFAOYSA-N |
| XLogP | -1.06 |
| TPSA | 128.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.21 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|